how many covalent bonds can selenium form

It has three unpaired electrons, each of which can make a covalent bond by sharing electrons with an H atom. There are no additional electrons to add to the central atom. Which one of the following is most likely to be an ionic compound ? six. Polyatomic ions are bonded together with covalent bonds. Each F atom has one bonding pair and three lone pairs of electrons. Selenium and oxygen are also both considered non-metals, which gives further evidence for the compound being covalent. For more information contact us at info@libretexts.org or check out our status page at https://status.libretexts.org. But it's a sliding scale, not black/white binary extremes: NaF is ionic, F2 is covalent, but obviously BF3 and CF4 must have bonds that are in between, with very polar bonds that can be described as having large amounts of both ionic and covalent character. Each F atom has three other pairs of electrons that do not participate in the bonding; they are called lone pair electrons. Example \(\PageIndex{3}\): Carbon Dioxide. 2. Covalent bonds are formed when atoms share electrons. He. Everett Herald Obituaries Past 30 Days, Put a pair of electrons between the central atom and each surrounding atom. 3.carbon-carbon triple bond is also pi bond and it is also covalent bond. - 14613392 8. Answer to 7. Incoherent Game Online Version, 2. Thank you. A good example of a common cost […], What is the best example of an economy’s stock […], Show transcribed image text Peroxyacids (RCO_3H) can […], Show transcribed image text 3. Suzuki Swift Rear Seat Removal, However, the O atom has only seven electrons around it, which is not a complete octet. Double ionic bond B. Quelle(n): covalent bonds carbon atom form: https://tr.im/3sGdk. Covalent bonding allows molecules to share electrons with other molecules, creating long chains of compounds and allowing more complexity in life. Put a pair of electrons between the central atom and each surrounding atom. Previous question Next question Get more help from Chegg. Comment; Complaint; Link; Know the Answer? If the rules for drawing Lewis electron dot diagrams do not work as written, a double bond may be required. Each bond consists of a shared pair of electrons, and is very strong. When did organ music become associated with baseball? How many electrons are shared between one nitrogen atom and one carbon atom? How many covalent bonds does carbon form if each of its unpaired electrons participate in one bond? There’s a general guideline that is helpful in figuring out the number of bonds each … Covalent bonds can be made between different elements as well. When electrons are shared between two atoms, they form a covalent bond. The valence of an element is the number of covalent bonds its atoms form or the charge on the ion it forms in ionic compounds. 2.c=c bond is pi bond and it is a covalent bond . Interestingly, most minerals are consumed in ionic form, rather than as elements or from covalent molecules. Trey Lander Tiktok Age. For simplicity's sake, it is not unusual to represent the covalent bond with a dash, instead of with two dots: Because two atoms are sharing one pair of electrons, this covalent bond is called a single bond. Selenium is an element that belongs to the fourth period/row of the periodic table. Christopher Lee Net Worth, The electron dot diagram of NH 3 is as follows: What Happened To Claudine Trillo And Jason Webb, How To Link Rockstar Social Club To Epic Games, How Did Andy Biersack And Juliet Simms Meet, Why Was It Difficult For American Ground Forces To Clear Areas Of Guerrillas Quizlet, How Long Does It Take To Digest Food And Poop It Out, Honeywell Thermostat Screen Not Responding, Spascriptions Daily Multivitamin Skincare System Reviews, Write Balanced Chemical Equation For The Following, Guildhall School Of Music And Drama Term Dates 2019 2020. Google Classroom Facebook Twitter. vor 1 Jahrzehnt. Ionic bonds: Reaction of metals & Non-metals. Complete the octets around the surrounding atoms (except for H). How many covalent bonds does iodine form? Penélope Fernandez Arias, Thank you. Put a pair of electrons between the central atom and each surrounding atom. 1. This means that a carbon atom can form 4 covalent bonds that means it can share its electrons with other atoms. Pineapple Sperm Theory, One example is HF. The way to solve this dilemma is to make a double bond between carbon and each O atom: Each O atom still has eight electrons around it, but now the C atom also has a complete octet. Count the total number of electrons. References. How many covalent bonds can a selenium atom usually form? 7 difference required for ionic compounds, so sodium fluoride is ionic. Jake Cherry Night At The Museum 3, Fifa 21 International Teams, Molecules that are made up of 2 atoms of the same element bonded together and thats it! Following the rules for Lewis electron dot diagrams for compounds gives us. How many bonds can fluorine form? How? 2 Comments / Bonding. The B atom is the central atom, and the F atoms are the surrounding atoms. If carbon forms 4 bonds rather than 2, twice as much energy is released and so the resulting molecule becomes even more stable. It is also possible to have a triple bond, in which there are three pairs of electrons between two atoms. Single and multiple covalent bonds. Yiga Clan Hideout Back Door, Each bond consists of a shared pair of electrons, and is very strong. This can be fixed by including a second H atom, whose single electron will make a second covalent bond with the O atom: (It does not matter what side the second H atom is positioned on.) The central atom is a C atom, with O atoms as surrounding atoms. Elements in row 3 and above may deviate from the guidelines as they can exceed octet. Simple molecular substances and giant covalent structures have different properties. 3.carbon-carbon triple bond is also pi bond and it is also covalent bond. Mozart Violin Concerto 3 Pdf, Devin Lucien Dj Parents, Swear To My Bones, The number of electrons required to obtain an octet determines the number of covalent bonds an atom can form. Rolex Femme Prix, (This explains why hydrogen is one of the diatomic elements.). Double bonds or triple bonds between atoms may be necessary to properly illustrate the bonding in some molecules. The compound cyanogen (CN)2 has covalent bonds shown in this diagram. explanation: 1.c-c bond is sigma bond and it is a covalent bond. And so that would form a covalent bond with that other hydrogen. 21 Bridges Screenplay Pdf, Why? There is only a small energy gap between the 2s and 2p orbitals, and so it pays the carbon to provide a small amount of energy to promote an electron from the 2s to the empty 2p to give 4 unpaired electrons. Therefore, we can conclude that a typical carbon atom form four covalent bonds. When electrons are shared between two atoms, they form a covalent bond. which explanation best defines a myth? Metallic bonds. Have peace of mind. This problem has been solved! Learn how to manage your mind and be optimistic even in the face of large and intimidating challenges. Simple molecular substances and giant covalent structures have different properties. How many covalent bonds can a selenium atom make. This is an acceptable Lewis electron dot diagram for CO2. Covalent bonds are formed between non-metals. The energy window where the contributions of the magnetic and spin quantum numbers are summed. Covalent bonds involve two atoms, typically nonmetals, that share electron density to form strong bonding interactions. Covalent bonds can be made between different elements as well. 1 s 2 2 s 2 2 p 6 3 s 2 3 p 6 3 d 10 4 s 2 4 p 6. a When some elements covalently bond, they form sp hybrid bonds.This is especially true for C, Si, and Ge. 4. H62 Brass Properties, Covalent bonds can be made between different elements as well. Charles Gray Cause Of Death, 0. Question: How Many Covalent Bonds Does Selenium Form. How many bonds can fluorine form? Covalent bonding allows molecules to share electrons with other molecules, creating long chains of compounds and allowing more complexity in life. Pokemon Sword Shiny Trade Code, Br. Register now! Covalent bonds are especially important since most carbon molecules interact primarily through covalent bonding. A covalent bond is a chemical bond that involves the sharing of electron pairs between atoms.These electron pairs are known as shared pairs or bonding pairs, and the stable balance of attractive and repulsive forces between atoms, when they share electrons, is known as covalent bonding. Minerals that the body needs in quantity include sodium, potassium, magnesium, calcium, phosphorus, sulfur, and chlorine. If a diet is lacking in a vitamin, diseases such as scurvy or rickets develop. Sometimes, however, these steps do not work. covalent. What is the proper Lewis electron dot diagram for CO2? Balwinder Sahani Wife, The O atoms have complete octets around them, but the C atom only has four electrons around it. The term is also used more generally to characterize any type of exponential or non-exponential decay. Tin atoms make covalent bonds. Br. Scientists can manipulate ionic properties and these interactions in order to form desired products. How many covalent bonds can a selenium atom usually form? Rêver De Se Laver Les Mains Avec Du Savon En Islam, Write the central atom and surround it with the surrounding atoms. The opposite charges of cations and anions exert a moderately strong mutual attraction that keeps the atoms in close proximity forming an ionic bond. Which of these is a correct compound name ? Expert Answer Answer Hey, look oxygen can form *zero* bonds to other atoms, too! 6. Carbon can form four covalent bonds at most, such as in methane. Half-life (symbol t 1⁄2) is the time required for a quantity to reduce to half of its initial value.The term is commonly used in nuclear physics to describe how quickly unstable atoms undergo radioactive decay or how long stable atoms survive. Because they are ions, however, they participate in ionic bonding with other ions. In the case of CH2O, the O and C atoms share two pairs of electrons, with the following Lewis electron dot diagram as a result: By circling the electrons around each atom, we can now see that the O and C atoms have octets, while each H atom has two electrons: Each valence shell is full, so this is an acceptable Lewis electron dot diagram. Carmelita Bohr Wiki, how many covalent bonds does selenium form. Now the O atom has a complete octet around it, and each H atom has two electrons, filling its valence shell. Unless otherwise noted, LibreTexts content is licensed by CC BY-NC-SA 3.0. chloro hydride As another example, consider fluorine. 1. Whale Sperm Size, Count the total number of electrons. Luckily, all vitamins are available as supplements, so any dietary deficiency in a vitamin can be easily corrected. nitrogen monoxide. Surf Dillon Beach, Krypton. Which one of the following is most likely to be an ionic compound ? Get one-on-one homework help from our expert tutors—available online 24/7. Bonding. Susan Li New Job, This problem has been solved! This uses up eight electrons, so we have 32 − 8 = 24 electrons left. If we were to follow these steps for the compound formaldehyde (CH2O), we would get the following: The H and O atoms have the proper number of electrons, but the C atom only has six electrons around it, not the eight electrons for an octet. If a diet is lacking in a vitamin, diseases such as scurvy or rickets develop. nitrogen monoxide. Bromine. Magnesium can only form metallic bonds, which are metal with metal and ionic bonds which are formed between metals and non-metals. We fix this by including a second H atom, whose single electron will make a second covalent bond with the O atom: (It does not matter on what side the second H atom is positioned.) Complete the octets around the surrounding atoms (except for H). Skiing Descriptive Essay, Answer. Monster Rancher 2 Disc List, Scientists can manipulate ionic properties and these interactions in order to form desired products. Imagine Me Book Read Online, Characteristics of Nonmetals. However, the O atom has only seven electrons around it, which is not a complete octet. Joey Diaz Sopranos, 36. For the following questions, use the position of an element in the periodic table to deduce its valence. How do we fix this? Covalent bonding allows molecules to share electrons with other molecules, creating long chains of compounds and allowing more complexity in life. The two H atoms can share their electrons: We can use circles to show that each H atom has two electrons around the nucleus, completely filling each atom's valence shell: Because each H atom has a filled valence shell, this bond is stable, and we have made a diatomic hydrogen molecule. Kr. HBr is very similar to HF, except that it has Br instead of F. The atoms are as follows: The two atoms can share their unpaired electron: Use Lewis electron dot diagrams to illustrate the covalent bond formation in Cl2. I believe the correct answer is 2. Michaela Coel Height, Scientists can manipulate ionic properties and these interactions in order to form desired products. Kossel-Lewis approach to chemical bond. Which of the following elements is an exception to the octet rule? Durga Jasraj Husband Name, There is a negative sign on the species, so we have an extra electron to consider. This uses up 24 more electrons, leaving 24 − 24 = 0 electrons left. This is the currently selected item. However, the O atom has only seven electrons around it, which is not a complete octet. Andy Petree Patrice Mcbride, Is John Cochran Married, Typically, the atoms of group 4A form 4 covalent bonds; group 5A form 3 bonds; group 6A form 2 bonds; and group 7A form one bond. Wilton Harry Potter Cookie Cutters, Sulfur can form two covalent bonds as in H2S, and can form 6 as in SO3. Apache No Module Named 'encodings, Food and Drink App: Vitamins and Minerals. How Does Mythology Influence Culture, a . What Happened To Claudine Trillo And Jason Webb, Formula unit refers to a substance that contains what type(s) of bond? There have been reports that atoms of element 116 were made by smashing smaller atoms together. So that forms a covalent bond with this hydrogen. The chemical symbols for the elements can be found in a periodic table. The electron dot diagram of NH3 is as follows: Use a Lewis electron dot diagram to show the covalent bonding in PCl3. An ionic bond is an ongoing, close association between ions of opposite charge. Put remaining electrons, if any, around the central atom. Magnesium can only form metallic bonds, which are metal with metal and ionic bonds which are formed between metals and non-metals. Answers (1) Ovadia 13 June, 13:40. I am in rishikesh just to attend the talks, Combien D'argent Rapporte Un Disque De Platine, Rêver De Se Laver Les Mains Avec Du Savon En Islam. Double bonds or triple bonds between atoms may be necessary to properly illustrate the bonding in some molecules. Covalent bonds form between non-metal atoms. Kindly read our fair use policy to understand how to best use our study materials. Double ionic bond B. Family Matriarch Poem, these are three possible … The ionic form of selenium (Se), for example, is typically written Se 2–. Find an answer to your question “What type of bond would form between two atoms of selenium?A. Use Lewis electron dot diagrams to illustrate the covalent bond formation in HBr. However, without even getting away from binary compounds and ions of H, C, N, and O, oxygen can be found forming bond orders of 1, 1.33, 1.5, 1.75, 2, 2.5, and 3, to either one, two, or three other atoms. Tf2 Sentry Toy, 2. Each H atom starts with a single electron in its valence shell: \[\mathbf{H\, \cdot }\; \; \; \; \; \mathbf{\cdot \: H}\nonumber \]. Minerals that the body needs in quantity include sodium, potassium, magnesium, calcium, phosphorus, sulfur, and chlorine. a. Valentino's Restaurant Impossible, 4. This is a good Lewis electron dot diagram for BF4−. \\end{array}$$. It most commonly forms covalent bonds. 12.4: Covalent Bonds and Lewis Structures, [ "article:topic", "single bond", "double bond", "triple bond", "valence shell", "covalent bond", "showtoc:no", "Lewis electron dot diagrams", "bonding electron pair", "lone pair electrons", "surrounding atoms", "central atom", "license:ccbyncsa", "transcluded:yes", "source-chem-64061", "source-chem-160099", "source-chem-171950", "source-chem-177404" ]. There are no additional electrons to add to the central atom. There have been reports that atoms of element 116 were made by smashing smaller atoms together. How Old Was Murray Goldberg When He Died, How many covalent bonds does carbon have? Guildhall School Of Music And Drama Term Dates 2019 2020, Caution: This method works well for elements in Rows 1 & 2. Complete the octets around the surrounding atoms (except for H). Fungus Among Us Lyrics, Br2I2N2Cl2H2O2F2(BrINClHOF) What are the 7 diatomic molecules? Email. Yes metals have covalent bonds because they have the power of losse electrons and make a covalent bond Thus vitamin A is also called retinol, vitamin C is called ascorbic acid, and vitamin E is called tocopherol. Witch Hazel For Strawberry Legs, Your email address will not be published. After the central and surrounding atoms have been identified, follow these steps: Let us try these steps to determine the electron dot diagram for BF4−. Daddy's Girl (2020), F atoms have seven electrons in their valence shell: These two atoms can do the same thing that the H atoms did; they share their unpaired electrons to make a covalent bond. Using the periodic table, determine what column element 116 would be in and suggest how many covalent bonds an atom of this element would form. First, you must identify the central atom and the surrounding atoms. Stuart Laundy Ex Wife, 34. We also acknowledge previous National Science Foundation support under grant numbers 1246120, 1525057, and 1413739. Dil Deewana Piano Notes, Pointeraner Puppies For Sale, Big Fish Analysis Essay, Answer to 7. This attraction is known as an ionic bond. In Cl2 molecule, each chlorine atom is surrounded by an octet number of electrons. The central atom N (group 5A) has 3 bonds and one lone pair. Like vitamins, most minerals are available in pill form, so any deficiency can be compensated for by taking supplements. \\end{array}$$. 12.4: Covalent Bonds and Lewis Structures, [ "article:topic", "single bond", "double bond", "triple bond", "valence shell", "covalent bond", "showtoc:no", "Lewis electron dot diagrams", "bonding electron pair", "lone pair electrons", "surrounding atoms", "central atom", "license:ccbyncsa", "transcluded:yes", "source-chem-64061", "source-chem-160099", "source-chem-171950", "source-chem-177404" ]. between elements in the molecule and the molecular … Covalent bonds. There is a negative sign on the species, so we have an extra electron to consider.

Neon (Ne) is a noblegas, as such it already has a filled electron shell (8 valence electrons) and don't form bonds to other atoms. Note that each F atom has a complete octet around it now: We can also write this using a dash to represent the shared electron pair: There are two different types of electrons in the fluorine diatomic molecule. Learn the best ways to handle pressure and deal with the high stress level of being a great success. 1 s 2 2 s 2 2 p 6 3 s 2 3 p 6 3 d 10 4 s 2 4 p 5. Bones Tv Series, net charge of –2. A carbon atom can form single, double or triple bond with other atoms. Single ionic bond C. Single covalent bond D. Double ...” in Chemistry if the answers seem to be not correct or there’s no answer. Predict the formula of a compound between tellurium and hydrogen. how many covalent bonds can boron form. 2. Selenium is an element that belongs to the fourth period/row of the periodic table. 1 s 2 2 s 2 2 p 6 3 s 2 3 p 6 3 d 10 4 s 2 4 p 4. Covalent bonds can be made between different elements as well. Bridget Rooney Pictures, 34. Following the rules for Lewis electron dot diagrams for compounds gives us. chloro hydride Free LibreFest conference on November 4-6! Poalirt of bond depends on electronegativity difference. Not Sure About the Answer? Covalent bonds are especially important since most carbon molecules interact primarily through covalent bonding. A covalent bond is a chemical bond that involves the sharing of electron pairs between atoms.These electron pairs are known as shared pairs or bonding pairs, and the stable balance of attractive and repulsive forces between atoms, when they share electrons, is known as covalent bonding. Simple molecular substances and giant covalent structures have different properties. It can lose its single valence electron in aqueous solution, leaving behind a bare proton with tremendous polarising power. NO. Because they are ions, however, they participate in ionic bonding with other ions. How many covalent bonds does element Mg form? Which type of elements tends to have the greatest attraction for electrons in a bond? Selenium can form upto 6 covalentbonds. How many covalent bonds does iodine form? The central atom is a C atom, with O atoms as surrounding atoms. Examine the Lewis structure of NCl3 below. Brigadoon Song Lyrics, More than two atoms can participate in covalent bonding, although any given covalent bond will be between two atoms only. The periodic table is divided into two broad groups: metals and nonmetals. What is the proper Lewis electron dot diagram for carbonyl sulfide (COS)? How many covalent bonds can a selenium atom make. There is a simple set of steps for determining the Lewis electron dot diagram of a simple molecule. 1. tetraphosphorus decoxide. nonmetals. Combien D'argent Rapporte Un Disque De Platine, Selenium. Thus vitamin A is also called retinol, vitamin C is called ascorbic acid, and vitamin E is called tocopherol. 3. Ask your own questions or browse existing Q&A threads. Minerals are also obtained from the diet. a . A carbon can form 4 covalent bonds, that's why carbon atom has the property tetravalent bonds!!! How do we fix this? F atoms have seven electrons in their valence shell: These two atoms can do the same thing that the H atoms did; they share their unpaired electrons to make a covalent bond. 4. c . The H and O atoms can share an electron to form a covalent bond: The H atom has a complete valence shell. Atoms with large differences in electronegativity transfer electrons to form ions. Interestingly, most minerals are consumed in ionic form, rather than as elements or from covalent molecules. Minerals are also obtained from the diet. Note that each F atom has a complete octet around it now: We can also write this using a dash to represent the shared electron pair: There are two different types of electrons in the fluorine diatomic molecule. Spascriptions Daily Multivitamin Skincare System Reviews, How many covalent bonds does hydrogen form if each of its unpaired electrons participate in one bond? how many covalent bonds does selenium form . a. one b. two c. three (:1. five e. zero © 2007. Write the central atom surrounded by surrounding atoms. Cognitive Science Minor Ucla Reddit, Why? Comment; Complaint; Link; Know the Answer? Clowance Poldark Second Husband, a . The ionic form of selenium (Se), for example, is typically written Se 2–. A selenium-chlorine bond should be more polar because of a greater difference in effective nuclear charge. Pooka Doll Hulu For Sale, One example is HF. Previous question Next question Get more help from Chegg. We’ve got course-specific notes, study guides, and practice tests along with expert tutors. Each atom starts out with an odd number of electrons in its valence shell: The two atoms can share their unpaired electrons to make a covalent bond: We note that the H atom has a full valence shell with two electrons, while the F atom has a complete octet of electrons. Example 4. Covalent bonds form between non-metal atoms. Rick Martel Wife, Stein Mart Gift Card Walmart, Single and multiple covalent bonds. Single ionic bond C. Single covalent bond D. Double ...” in Chemistry if the answers seem to be not correct or there’s no answer. Foreclosed Log Homes In Tennessee, Ever. There is only a small energy gap between the 2s and 2p orbitals, and so it pays the carbon to provide a small amount of energy to promote an electron from the 2s to the empty 2p to give 4 unpaired electrons. Draw the structural formula for each compound: a. molecular oxygen (O 2) b. carbon dioxide (CO 2) c. phosphoric acid (H 3 PO 4) … Alex Maragos Parents, And now here, once again, oxygen can kinda pretend like it has eight valence electrons, two, four, six, eight. Expert Answer . Write Balanced Chemical Equation For The Following, The compound ethylene (C2H4) is represented by this diagram. Suge Jacob Knight Jr Age, 7 difference required for ionic compounds, so sodium fluoride is ionic. Examine the Lewis structure of NCl3 below. Which one of the following is most likely to be a covalent compound ? An ionic bond is an ongoing, close association between ions of opposite charge. The N atom has the following Lewis electron dot diagram: It has three unpaired electrons, each of which can make a covalent bond by sharing electrons with an H atom. The B atom is the central atom, and the F atoms are the surrounding atoms. Kr. And then this electron from the oxygen can be shared with the hydrogen, and that electron from the hydrogen can be shared with the oxygen. Find an answer to your question “What type of bond would form between two atoms of selenium?A. Microtech Tri Wing Screws, Social Phenomenon Examples 2019, Expert Answer . Tin atoms make covalent bonds. Predict the formula of a compound between tellurium and hydrogen. Add extra if the species has negative charges and remove some for every positive charge on the species. Fluorine and the other halogens in group 7A (17) have seven valence electrons and can obtain an octet by forming one covalent bond. See the answer. How many covalent bonds can a selenium atom usually form? Consider H and O atoms: The H and O atoms can share an electron to form a covalent bond: The H atom has a complete valence shell. Neon cannot form covalent bonds as it has no lone pairs of electrons However it can form some ionic bonds such as (NeAr)+, (NeH)+ and (NeHe)+ 17 18 19 Asked in Chemistry, Elements and Compounds,. How many covalent bonds can a carbon atom form? Google Sphere Lava, For simplicity's sake, it is not unusual to represent the covalent bond with a dash, instead of with two dots: Because two atoms are sharing one pair of electrons, this covalent bond is called a single bond. Dox Thrash, Defense Worker Medium, Covalent compounds. Caution: This method works well for elements in Rows 1 & 2. Penn Badgley Vampire Diaries, 1. Aleysha Nicky Jam, This is much deeper than the calculated values of 0.2-0.4 eV. 1 s 2 2 s 2 2 p 6 3 s 2 3 p 6 3 d 10 4 s 2 4 p 6. a When some elements covalently bond, they form sp hybrid bonds.This is especially true for C, Si, and Ge. How many covalent bonds can each atom form, such that the resulting molecule is neutral in charge? If we were to follow these steps for the compound formaldehyde (CH2O), we would get the following: The H and O atoms have the proper number of electrons, but the C atom only has six electrons around it, not the eight electrons for an octet. Each atom starts out with an odd number of electrons in its valence shell: The two atoms can share their unpaired electrons to make a covalent bond: Note that the H atom has a full valence shell with two electrons, while the F atom has a complete octet of electrons. Molecules, such like breathable oxygen (O 2) and water (H 2 O), form as a result of bonds between atoms. Most of them are commonly named with a letter, although all of them also have formal chemical names. Which of these is a correct compound name ? The central atom is a C atom, with O atoms as surrounding atoms. How Did Andy Biersack And Juliet Simms Meet, However, some atoms will not give up or gain electrons easily. C b. H c. O d. N e. P f. S 2. Its atomic number is 12, which means it has 12 protons and 12 electrons. Let us illustrate a covalent bond by using H atoms, with the understanding that H atoms need only two electrons to fill the 1s subshell.

Glider Rocker Recliner, Correlation Meaning In Statistics, Samsung Washing Machine Warranty, How Much Should I Squat For My Weight, Be Mine Tonight,